C46H26N2O4S6 — CID 167050681
dibenzyl 4,11-bis[[1,3-bis(sulfanylidene)inden-2-ylidene]methyl]-3,10-dithia-7,14-diazatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13),11-pentaene-7,14-dicarboxylate (PubChem CID 167050681) has the molecular formula C46H26N2O4S6 and a molecular weight of 863.13 g/mol. Its IUPAC name is dibenzyl 4,11-bis[[1,3-bis(sulfanylidene)inden-2-ylidene]methyl]-3,10-dithia-7,14-diazatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13),11-pentaene-7,14-dicarboxylate.
| Compound Name | dibenzyl 4,11-bis[[1,3-bis(sulfanylidene)inden-2-ylidene]methyl]-3,10-dithia-7,14-diazatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13),11-pentaene-7,14-dicarboxylate |
|---|---|
| PubChem CID | 167050681 |
| Molecular Formula | C46H26N2O4S6 |
| Molecular Weight | 863.13 g/mol |
| Exact Mass | 862.02 |
| IUPAC Name | dibenzyl 4,11-bis[[1,3-bis(sulfanylidene)inden-2-ylidene]methyl]-3,10-dithia-7,14-diazatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13),11-pentaene-7,14-dicarboxylate |
| SMILES | O=C(OCc1ccccc1)n1c2cc(C=C3C(=S)c4ccccc4C3=S)sc2c2c1c1sc(C=C3C(=S)c4ccccc4C3=S)cc1n2C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C46H26N2O4S6/c49-45(51-23-25-11-3-1-4-12-25)47-35-21-27(19-33-39(53)29-15-7-8-16-30(29)40(33)54)57-43(35)38-37(47)44-36(48(38)46(50)52-24-26-13-5-2-6-14-26)22-28(58-44)20-34-41(55)31-17-9-10-18-32(31)42(34)56/h1-22H,23-24H2 |
| InChIKey | LJCUZHLGSYOBSX-UHFFFAOYSA-N |
| XLogP | 12.31 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 863.13 |
| LogP ≤ 5 | 12.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|