C36H17N7O4S6 — CID 167050707
benzyl 6,14-bis[5-(dicyanomethylideneamino)-3-methoxythiophen-2-yl]-3,7,13,17-tetrathia-10-azapentacyclo[9.6.0.02,9.04,8.012,16]heptadeca-1(11),2(9),4(8),5,12(16),14-hexaene-10-carboxylate (PubChem CID 167050707) has the molecular formula C36H17N7O4S6 and a molecular weight of 803.98 g/mol. Its IUPAC name is benzyl 6,14-bis[5-(dicyanomethylideneamino)-3-methoxythiophen-2-yl]-3,7,13,17-tetrathia-10-azapentacyclo[9.6.0.02,9.04,8.012,16]heptadeca-1(11),2(9),4(8),5,12(16),14-hexaene-10-carboxylate.
| Compound Name | benzyl 6,14-bis[5-(dicyanomethylideneamino)-3-methoxythiophen-2-yl]-3,7,13,17-tetrathia-10-azapentacyclo[9.6.0.02,9.04,8.012,16]heptadeca-1(11),2(9),4(8),5,12(16),14-hexaene-10-carboxylate |
|---|---|
| PubChem CID | 167050707 |
| Molecular Formula | C36H17N7O4S6 |
| Molecular Weight | 803.98 g/mol |
| Exact Mass | 802.97 |
| IUPAC Name | benzyl 6,14-bis[5-(dicyanomethylideneamino)-3-methoxythiophen-2-yl]-3,7,13,17-tetrathia-10-azapentacyclo[9.6.0.02,9.04,8.012,16]heptadeca-1(11),2(9),4(8),5,12(16),14-hexaene-10-carboxylate |
| SMILES | COc1cc(N=C(C#N)C#N)sc1-c1cc2sc3c4sc5cc(-c6sc(N=C(C#N)C#N)cc6OC)sc5c4n(C(=O)OCc4ccccc4)c3c2s1 |
| InChI | InChI=1S/C36H17N7O4S6/c1-45-20-8-26(41-18(12-37)13-38)52-30(20)22-10-24-32(48-22)28-34(50-24)35-29(43(28)36(44)47-16-17-6-4-3-5-7-17)33-25(51-35)11-23(49-33)31-21(46-2)9-27(53-31)42-19(14-39)15-40/h3-11H,16H2,1-2H3 |
| InChIKey | HLXMGKUCQCIDHF-UHFFFAOYSA-N |
| XLogP | 11.25 |
| TPSA | 169.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.98 |
| LogP ≤ 5 | 11.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|