C36H18N8O4S2 — CID 167050742
dibenzyl 6,15-bis(dicyanomethylideneamino)-5,14-dithia-9,18-diazapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1(12),2,4(8),6,10,13(17),15-heptaene-9,18-dicarboxylate (PubChem CID 167050742) has the molecular formula C36H18N8O4S2 and a molecular weight of 690.73 g/mol. Its IUPAC name is dibenzyl 6,15-bis(dicyanomethylideneamino)-5,14-dithia-9,18-diazapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1(12),2,4(8),6,10,13(17),15-heptaene-9,18-dicarboxylate.
| Compound Name | dibenzyl 6,15-bis(dicyanomethylideneamino)-5,14-dithia-9,18-diazapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1(12),2,4(8),6,10,13(17),15-heptaene-9,18-dicarboxylate |
|---|---|
| PubChem CID | 167050742 |
| Molecular Formula | C36H18N8O4S2 |
| Molecular Weight | 690.73 g/mol |
| Exact Mass | 690.09 |
| IUPAC Name | dibenzyl 6,15-bis(dicyanomethylideneamino)-5,14-dithia-9,18-diazapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1(12),2,4(8),6,10,13(17),15-heptaene-9,18-dicarboxylate |
| SMILES | N#CC(C#N)=Nc1cc2c(s1)c1cc3c(cc1n2C(=O)OCc1ccccc1)c1sc(N=C(C#N)C#N)cc1n3C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C36H18N8O4S2/c37-15-23(16-38)41-31-13-29-33(49-31)25-12-28-26(11-27(25)43(29)35(45)47-19-21-7-3-1-4-8-21)34-30(14-32(50-34)42-24(17-39)18-40)44(28)36(46)48-20-22-9-5-2-6-10-22/h1-14H,19-20H2 |
| InChIKey | HXCNODJALLRQRT-UHFFFAOYSA-N |
| XLogP | 8.63 |
| TPSA | 182.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.73 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|