C32H17N7O4S4 — CID 167050783
benzyl 4,10-bis[5-(dicyanomethylideneamino)-3-methoxythiophen-2-yl]-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-7-carboxylate (PubChem CID 167050783) has the molecular formula C32H17N7O4S4 and a molecular weight of 691.80 g/mol. Its IUPAC name is benzyl 4,10-bis[5-(dicyanomethylideneamino)-3-methoxythiophen-2-yl]-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-7-carboxylate.
| Compound Name | benzyl 4,10-bis[5-(dicyanomethylideneamino)-3-methoxythiophen-2-yl]-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-7-carboxylate |
|---|---|
| PubChem CID | 167050783 |
| Molecular Formula | C32H17N7O4S4 |
| Molecular Weight | 691.80 g/mol |
| Exact Mass | 691.02 |
| IUPAC Name | benzyl 4,10-bis[5-(dicyanomethylideneamino)-3-methoxythiophen-2-yl]-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-7-carboxylate |
| SMILES | COc1cc(N=C(C#N)C#N)sc1-c1cc2c(s1)c1sc(-c3sc(N=C(C#N)C#N)cc3OC)cc1n2C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C32H17N7O4S4/c1-41-22-10-26(37-18(12-33)13-34)46-30(22)24-8-20-28(44-24)29-21(39(20)32(40)43-16-17-6-4-3-5-7-17)9-25(45-29)31-23(42-2)11-27(47-31)38-19(14-35)15-36/h3-11H,16H2,1-2H3 |
| InChIKey | KDOOAMBQFFEVIG-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 169.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.80 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|