C36H19NO2S6 — CID 167050784
benzyl 4,10-bis[[1,3-bis(sulfanylidene)inden-2-ylidene]methyl]-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-7-carboxylate (PubChem CID 167050784) has the molecular formula C36H19NO2S6 and a molecular weight of 689.96 g/mol. Its IUPAC name is benzyl 4,10-bis[[1,3-bis(sulfanylidene)inden-2-ylidene]methyl]-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-7-carboxylate.
| Compound Name | benzyl 4,10-bis[[1,3-bis(sulfanylidene)inden-2-ylidene]methyl]-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-7-carboxylate |
|---|---|
| PubChem CID | 167050784 |
| Molecular Formula | C36H19NO2S6 |
| Molecular Weight | 689.96 g/mol |
| Exact Mass | 688.97 |
| IUPAC Name | benzyl 4,10-bis[[1,3-bis(sulfanylidene)inden-2-ylidene]methyl]-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-7-carboxylate |
| SMILES | O=C(OCc1ccccc1)n1c2cc(C=C3C(=S)c4ccccc4C3=S)sc2c2sc(C=C3C(=S)c4ccccc4C3=S)cc21 |
| InChI | InChI=1S/C36H19NO2S6/c38-36(39-18-19-8-2-1-3-9-19)37-28-16-20(14-26-30(40)22-10-4-5-11-23(22)31(26)41)44-34(28)35-29(37)17-21(45-35)15-27-32(42)24-12-6-7-13-25(24)33(27)43/h1-17H,18H2 |
| InChIKey | CHCOXMDYGCAELT-UHFFFAOYSA-N |
| XLogP | 10.17 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.96 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|