C42H20N8O4S5 — CID 167051274
dibenzyl 6,14-bis[5-(dicyanomethylideneamino)thiophen-2-yl]-7,10,13-trithia-3,17-diazapentacyclo[9.6.0.02,9.04,8.012,16]heptadeca-1(11),2(9),4(8),5,12(16),14-hexaene-3,17-dicarboxylate (PubChem CID 167051274) has the molecular formula C42H20N8O4S5 and a molecular weight of 861.01 g/mol. Its IUPAC name is dibenzyl 6,14-bis[5-(dicyanomethylideneamino)thiophen-2-yl]-7,10,13-trithia-3,17-diazapentacyclo[9.6.0.02,9.04,8.012,16]heptadeca-1(11),2(9),4(8),5,12(16),14-hexaene-3,17-dicarboxylate.
| Compound Name | dibenzyl 6,14-bis[5-(dicyanomethylideneamino)thiophen-2-yl]-7,10,13-trithia-3,17-diazapentacyclo[9.6.0.02,9.04,8.012,16]heptadeca-1(11),2(9),4(8),5,12(16),14-hexaene-3,17-dicarboxylate |
|---|---|
| PubChem CID | 167051274 |
| Molecular Formula | C42H20N8O4S5 |
| Molecular Weight | 861.01 g/mol |
| Exact Mass | 860.02 |
| IUPAC Name | dibenzyl 6,14-bis[5-(dicyanomethylideneamino)thiophen-2-yl]-7,10,13-trithia-3,17-diazapentacyclo[9.6.0.02,9.04,8.012,16]heptadeca-1(11),2(9),4(8),5,12(16),14-hexaene-3,17-dicarboxylate |
| SMILES | N#CC(C#N)=Nc1ccc(-c2cc3c(s2)c2sc4c5sc(-c6ccc(N=C(C#N)C#N)s6)cc5n(C(=O)OCc5ccccc5)c4c2n3C(=O)OCc2ccccc2)s1 |
| InChI | InChI=1S/C42H20N8O4S5/c43-17-25(18-44)47-33-13-11-29(55-33)31-15-27-37(57-31)39-35(49(27)41(51)53-21-23-7-3-1-4-8-23)36-40(59-39)38-28(50(36)42(52)54-22-24-9-5-2-6-10-24)16-32(58-38)30-12-14-34(56-30)48-26(19-45)20-46/h1-16H,21-22H2 |
| InChIKey | OELBGVOLSRMTRX-UHFFFAOYSA-N |
| XLogP | 12.15 |
| TPSA | 182.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 861.01 |
| LogP ≤ 5 | 12.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|