C38H25N7O4S5 — CID 167051558
benzyl 4,11-bis[5-(dicyanomethylideneamino)-3-propoxythiophen-2-yl]-3,7,10-trithia-14-azatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13),11-pentaene-14-carboxylate (PubChem CID 167051558) has the molecular formula C38H25N7O4S5 and a molecular weight of 804.00 g/mol. Its IUPAC name is benzyl 4,11-bis[5-(dicyanomethylideneamino)-3-propoxythiophen-2-yl]-3,7,10-trithia-14-azatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13),11-pentaene-14-carboxylate.
| Compound Name | benzyl 4,11-bis[5-(dicyanomethylideneamino)-3-propoxythiophen-2-yl]-3,7,10-trithia-14-azatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13),11-pentaene-14-carboxylate |
|---|---|
| PubChem CID | 167051558 |
| Molecular Formula | C38H25N7O4S5 |
| Molecular Weight | 804.00 g/mol |
| Exact Mass | 803.06 |
| IUPAC Name | benzyl 4,11-bis[5-(dicyanomethylideneamino)-3-propoxythiophen-2-yl]-3,7,10-trithia-14-azatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13),11-pentaene-14-carboxylate |
| SMILES | CCCOc1cc(N=C(C#N)C#N)sc1-c1cc2c(s1)c1sc3cc(-c4sc(N=C(C#N)C#N)cc4OCCC)sc3c1n2C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C38H25N7O4S5/c1-3-10-47-25-13-30(43-22(16-39)17-40)53-34(25)27-12-24-33(50-27)37-32(45(24)38(46)49-20-21-8-6-5-7-9-21)36-29(52-37)15-28(51-36)35-26(48-11-4-2)14-31(54-35)44-23(18-41)19-42/h5-9,12-15H,3-4,10-11,20H2,1-2H3 |
| InChIKey | CFYBOUWGWKKXLW-UHFFFAOYSA-N |
| XLogP | 11.59 |
| TPSA | 169.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.00 |
| LogP ≤ 5 | 11.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|