C12H24F2 — CID 167051868
(3R,7S)-3,7-difluoro-2,2,6,6-tetramethyloctane (PubChem CID 167051868) has the molecular formula C12H24F2 and a molecular weight of 206.32 g/mol. Its IUPAC name is (3R,7S)-3,7-difluoro-2,2,6,6-tetramethyloctane.
| Compound Name | (3R,7S)-3,7-difluoro-2,2,6,6-tetramethyloctane |
|---|---|
| PubChem CID | 167051868 |
| Molecular Formula | C12H24F2 |
| Molecular Weight | 206.32 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | (3R,7S)-3,7-difluoro-2,2,6,6-tetramethyloctane |
| SMILES | C[C@H](F)C(C)(C)CC[C@@H](F)C(C)(C)C |
| InChI | InChI=1S/C12H24F2/c1-9(13)12(5,6)8-7-10(14)11(2,3)4/h9-10H,7-8H2,1-6H3/t9-,10+/m0/s1 |
| InChIKey | LIQNYVNJLAUDGN-VHSXEESVSA-N |
| XLogP | 4.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.32 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |