C46H32N8O6S4 — CID 167051876
dibenzyl 4,11-bis[5-(dicyanomethylideneamino)-3-propoxythiophen-2-yl]-7,14-dithia-3,10-diazatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13),11-pentaene-3,10-dicarboxylate (PubChem CID 167051876) has the molecular formula C46H32N8O6S4 and a molecular weight of 921.08 g/mol. Its IUPAC name is dibenzyl 4,11-bis[5-(dicyanomethylideneamino)-3-propoxythiophen-2-yl]-7,14-dithia-3,10-diazatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13),11-pentaene-3,10-dicarboxylate.
| Compound Name | dibenzyl 4,11-bis[5-(dicyanomethylideneamino)-3-propoxythiophen-2-yl]-7,14-dithia-3,10-diazatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13),11-pentaene-3,10-dicarboxylate |
|---|---|
| PubChem CID | 167051876 |
| Molecular Formula | C46H32N8O6S4 |
| Molecular Weight | 921.08 g/mol |
| Exact Mass | 920.13 |
| IUPAC Name | dibenzyl 4,11-bis[5-(dicyanomethylideneamino)-3-propoxythiophen-2-yl]-7,14-dithia-3,10-diazatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13),11-pentaene-3,10-dicarboxylate |
| SMILES | CCCOc1cc(N=C(C#N)C#N)sc1-c1cc2sc3c(sc4cc(-c5sc(N=C(C#N)C#N)cc5OCCC)n(C(=O)OCc5ccccc5)c43)c2n1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C46H32N8O6S4/c1-3-15-57-33-19-37(51-29(21-47)22-48)63-41(33)31-17-35-39(53(31)45(55)59-25-27-11-7-5-8-12-27)43-44(61-35)40-36(62-43)18-32(54(40)46(56)60-26-28-13-9-6-10-14-28)42-34(58-16-4-2)20-38(64-42)52-30(23-49)24-50/h5-14,17-20H,3-4,15-16,25-26H2,1-2H3 |
| InChIKey | PLQRLUDJFJYBFH-UHFFFAOYSA-N |
| XLogP | 12.52 |
| TPSA | 200.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 921.08 |
| LogP ≤ 5 | 12.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|