C42H15N5O6S3 — CID 167051894
benzyl 4,11-bis[(5,6-dicyano-1,3-dioxoinden-2-ylidene)methyl]-3,7,10-trithia-14-azatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13),11-pentaene-14-carboxylate (PubChem CID 167051894) has the molecular formula C42H15N5O6S3 and a molecular weight of 781.81 g/mol. Its IUPAC name is benzyl 4,11-bis[(5,6-dicyano-1,3-dioxoinden-2-ylidene)methyl]-3,7,10-trithia-14-azatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13),11-pentaene-14-carboxylate.
| Compound Name | benzyl 4,11-bis[(5,6-dicyano-1,3-dioxoinden-2-ylidene)methyl]-3,7,10-trithia-14-azatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13),11-pentaene-14-carboxylate |
|---|---|
| PubChem CID | 167051894 |
| Molecular Formula | C42H15N5O6S3 |
| Molecular Weight | 781.81 g/mol |
| Exact Mass | 781.02 |
| IUPAC Name | benzyl 4,11-bis[(5,6-dicyano-1,3-dioxoinden-2-ylidene)methyl]-3,7,10-trithia-14-azatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13),11-pentaene-14-carboxylate |
| SMILES | N#Cc1cc2c(cc1C#N)C(=O)C(=Cc1cc3c(s1)c1sc4cc(C=C5C(=O)c6cc(C#N)c(C#N)cc6C5=O)sc4c1n3C(=O)OCc1ccccc1)C2=O |
| InChI | InChI=1S/C42H15N5O6S3/c43-14-20-6-26-27(7-21(20)15-44)36(49)30(35(26)48)10-24-12-32-39(54-24)41-34(47(32)42(52)53-18-19-4-2-1-3-5-19)40-33(56-41)13-25(55-40)11-31-37(50)28-8-22(16-45)23(17-46)9-29(28)38(31)51/h1-13H,18H2 |
| InChIKey | CQKVINDWPIJEET-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 194.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.81 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|