About CID 167051907
CID 167051907 (PubChem CID 167051907) has the molecular formula C43H40O4S2
and a molecular weight of 684.92 g/mol.
Molecular Properties
| Compound Name | CID 167051907 |
| PubChem CID | 167051907 |
| Molecular Formula | C43H40O4S2 |
| Molecular Weight | 684.92 g/mol |
| Exact Mass | 684.24 |
| IUPAC Name | — |
| SMILES | C=C/C=C1/C(=O)/C(=C\C2=CC3=C(c4sc5cc(C=C6C(=O)C(=C/C)/C(=C\C)C6=O)sc5c4C34CCCCC4)C23CCCCC3)C(=O)/C1=C/C |
| InChI | InChI=1S/C43H40O4S2/c1-5-15-29-28(8-4)38(46)30(39(29)47)20-24-21-32-34(42(24)16-11-9-12-17-42)41-35(43(32)18-13-10-14-19-43)40-33(49-41)23-25(48-40)22-31-36(44)26(6-2)27(7-3)37(31)45/h5-8,15,20-23H,1,9-14,16-19H2,2-4H3/b26-6+,27-7+,28-8+,29-15+,30-20- |
| InChIKey | KZKPUFUOVYGWKA-UYRLWDFWSA-N |
| XLogP | 10.39 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 49 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 684.92 |
| LogP ≤ 5 | 10.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze CID 167051907 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 167051907?
The IUPAC name of CID 167051907 (CID 167051907) is not available.
What is the SMILES notation for CID 167051907?
The canonical SMILES for CID 167051907 is C=C/C=C1/C(=O)/C(=C\C2=CC3=C(c4sc5cc(C=C6C(=O)C(=C/C)/C(=C\C)C6=O)sc5c4C34CCCCC4)C23CCCCC3)C(=O)/C1=C/C.
What is the InChIKey of CID 167051907?
The InChIKey is KZKPUFUOVYGWKA-UYRLWDFWSA-N. The full InChI is InChI=1S/C43H40O4S2/c1-5-15-29-28(8-4)38(46)30(39(29)47)20-24-21-32-34(42(24)16-11-9-12-17-42)41-35(43(32)18-13-10-14-19-43)40-33(49-41)23-25(48-40)22-31-36(44)26(6-2)27(7-3)37(31)45/h5-8,15,20-23H,1,9-14,16-19H2,2-4H3/b26-6+,27-7+,28-8+,29-15+,30-20-.
What are the key properties of CID 167051907?
CID 167051907 has a molecular weight of 684.92 g/mol, XLogP of 10.39, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 167051907 is sourced from PubChem (CID 167051907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).