About [(E)-[2,2,2-trifluoro-1-(4-methoxynaphthalen-1-yl)ethylidene]amino] trifluoromethanesulfonate
[(E)-[2,2,2-trifluoro-1-(4-methoxynaphthalen-1-yl)ethylidene]amino] trifluoromethanesulfonate (PubChem CID 167051958) has the molecular formula C14H9F6NO4S
and a molecular weight of 401.28 g/mol. Its IUPAC name is [(E)-[2,2,2-trifluoro-1-(4-methoxynaphthalen-1-yl)ethylidene]amino] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [(E)-[2,2,2-trifluoro-1-(4-methoxynaphthalen-1-yl)ethylidene]amino] trifluoromethanesulfonate |
| PubChem CID | 167051958 |
| Molecular Formula | C14H9F6NO4S |
| Molecular Weight | 401.28 g/mol |
| Exact Mass | 401.02 |
| IUPAC Name | [(E)-[2,2,2-trifluoro-1-(4-methoxynaphthalen-1-yl)ethylidene]amino] trifluoromethanesulfonate |
| SMILES | COc1ccc(/C(=N\OS(=O)(=O)C(F)(F)F)C(F)(F)F)c2ccccc12 |
| InChI | InChI=1S/C14H9F6NO4S/c1-24-11-7-6-10(8-4-2-3-5-9(8)11)12(13(15,16)17)21-25-26(22,23)14(18,19)20/h2-7H,1H3/b21-12+ |
| InChIKey | DFBIUEVCCIARFO-CIAFOILYSA-N |
| XLogP | 3.98 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.28 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [(E)-[2,2,2-trifluoro-1-(4-methoxynaphthalen-1-yl)ethylidene]amino] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-[2,2,2-trifluoro-1-(4-methoxynaphthalen-1-yl)ethylidene]amino] trifluoromethanesulfonate?
The IUPAC name of [(E)-[2,2,2-trifluoro-1-(4-methoxynaphthalen-1-yl)ethylidene]amino] trifluoromethanesulfonate (CID 167051958) is [(E)-[2,2,2-trifluoro-1-(4-methoxynaphthalen-1-yl)ethylidene]amino] trifluoromethanesulfonate.
What is the SMILES notation for [(E)-[2,2,2-trifluoro-1-(4-methoxynaphthalen-1-yl)ethylidene]amino] trifluoromethanesulfonate?
The canonical SMILES for [(E)-[2,2,2-trifluoro-1-(4-methoxynaphthalen-1-yl)ethylidene]amino] trifluoromethanesulfonate is COc1ccc(/C(=N\OS(=O)(=O)C(F)(F)F)C(F)(F)F)c2ccccc12.
What is the InChIKey of [(E)-[2,2,2-trifluoro-1-(4-methoxynaphthalen-1-yl)ethylidene]amino] trifluoromethanesulfonate?
The InChIKey is DFBIUEVCCIARFO-CIAFOILYSA-N. The full InChI is InChI=1S/C14H9F6NO4S/c1-24-11-7-6-10(8-4-2-3-5-9(8)11)12(13(15,16)17)21-25-26(22,23)14(18,19)20/h2-7H,1H3/b21-12+.
What are the key properties of [(E)-[2,2,2-trifluoro-1-(4-methoxynaphthalen-1-yl)ethylidene]amino] trifluoromethanesulfonate?
[(E)-[2,2,2-trifluoro-1-(4-methoxynaphthalen-1-yl)ethylidene]amino] trifluoromethanesulfonate has a molecular weight of 401.28 g/mol, XLogP of 3.98, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-[2,2,2-trifluoro-1-(4-methoxynaphthalen-1-yl)ethylidene]amino] trifluoromethanesulfonate is sourced from PubChem (CID 167051958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).