About (E)-2-methyl-3-(1,3,5-trimethyl-2-methylidene-4-pyridinyl)prop-2-en-1-imine
(E)-2-methyl-3-(1,3,5-trimethyl-2-methylidene-4-pyridinyl)prop-2-en-1-imine (PubChem CID 167052086) has the molecular formula C13H18N2
and a molecular weight of 202.30 g/mol. Its IUPAC name is (E)-2-methyl-3-(1,3,5-trimethyl-2-methylidene-4-pyridinyl)prop-2-en-1-imine.
Molecular Properties
| Compound Name | (E)-2-methyl-3-(1,3,5-trimethyl-2-methylidene-4-pyridinyl)prop-2-en-1-imine |
| PubChem CID | 167052086 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | (E)-2-methyl-3-(1,3,5-trimethyl-2-methylidene-4-pyridinyl)prop-2-en-1-imine |
| SMILES | [H]/N=C/C(C)=C/C1=C(C)C(=C)N(C)C=C1C |
| InChI | InChI=1S/C13H18N2/c1-9(7-14)6-13-10(2)8-15(5)12(4)11(13)3/h6-8,14H,4H2,1-3,5H3/b9-6+,14-7+ |
| InChIKey | GLTXOXZWRDBZMH-GTXFBGKMSA-N |
| XLogP | 3.26 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-methyl-3-(1,3,5-trimethyl-2-methylidene-4-pyridinyl)prop-2-en-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-methyl-3-(1,3,5-trimethyl-2-methylidene-4-pyridinyl)prop-2-en-1-imine?
The IUPAC name of (E)-2-methyl-3-(1,3,5-trimethyl-2-methylidene-4-pyridinyl)prop-2-en-1-imine (CID 167052086) is (E)-2-methyl-3-(1,3,5-trimethyl-2-methylidene-4-pyridinyl)prop-2-en-1-imine.
What is the SMILES notation for (E)-2-methyl-3-(1,3,5-trimethyl-2-methylidene-4-pyridinyl)prop-2-en-1-imine?
The canonical SMILES for (E)-2-methyl-3-(1,3,5-trimethyl-2-methylidene-4-pyridinyl)prop-2-en-1-imine is [H]/N=C/C(C)=C/C1=C(C)C(=C)N(C)C=C1C.
What is the InChIKey of (E)-2-methyl-3-(1,3,5-trimethyl-2-methylidene-4-pyridinyl)prop-2-en-1-imine?
The InChIKey is GLTXOXZWRDBZMH-GTXFBGKMSA-N. The full InChI is InChI=1S/C13H18N2/c1-9(7-14)6-13-10(2)8-15(5)12(4)11(13)3/h6-8,14H,4H2,1-3,5H3/b9-6+,14-7+.
What are the key properties of (E)-2-methyl-3-(1,3,5-trimethyl-2-methylidene-4-pyridinyl)prop-2-en-1-imine?
(E)-2-methyl-3-(1,3,5-trimethyl-2-methylidene-4-pyridinyl)prop-2-en-1-imine has a molecular weight of 202.30 g/mol, XLogP of 3.26, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-methyl-3-(1,3,5-trimethyl-2-methylidene-4-pyridinyl)prop-2-en-1-imine is sourced from PubChem (CID 167052086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).