About CID 167052191
CID 167052191 (PubChem CID 167052191) has the molecular formula C42H43N8O3S2-
and a molecular weight of 771.99 g/mol.
Molecular Properties
| Compound Name | CID 167052191 |
| PubChem CID | 167052191 |
| Molecular Formula | C42H43N8O3S2- |
| Molecular Weight | 771.99 g/mol |
| Exact Mass | 771.29 |
| IUPAC Name | — |
| SMILES | CCN(CC)CC/N=[S-](=O)/c1ccc(N(c2ccc(-c3c[nH]c(=O)c(-c4cc5ccccc5[nH]4)c3)cc2)c2ncc(-c3cccs3)c(N[C@H](C)CO)n2)cc1 |
| InChI | InChI=1S/C42H43N8O3S2/c1-4-49(5-2)21-20-45-55(53)34-18-16-33(17-19-34)50(42-44-26-36(39-11-8-22-54-39)40(48-42)46-28(3)27-51)32-14-12-29(13-15-32)31-23-35(41(52)43-25-31)38-24-30-9-6-7-10-37(30)47-38/h6-19,22-26,28,47,51H,4-5,20-21,27H2,1-3H3,(H,43,52)(H,44,46,48)/q-1/t28-/m1/s1 |
| InChIKey | JNWWIYREMDYNEW-MUUNZHRXSA-N |
| XLogP | 8.82 |
| TPSA | 142.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 55 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 771.99 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze CID 167052191 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 167052191?
The IUPAC name of CID 167052191 (CID 167052191) is not available.
What is the SMILES notation for CID 167052191?
The canonical SMILES for CID 167052191 is CCN(CC)CC/N=[S-](=O)/c1ccc(N(c2ccc(-c3c[nH]c(=O)c(-c4cc5ccccc5[nH]4)c3)cc2)c2ncc(-c3cccs3)c(N[C@H](C)CO)n2)cc1.
What is the InChIKey of CID 167052191?
The InChIKey is JNWWIYREMDYNEW-MUUNZHRXSA-N. The full InChI is InChI=1S/C42H43N8O3S2/c1-4-49(5-2)21-20-45-55(53)34-18-16-33(17-19-34)50(42-44-26-36(39-11-8-22-54-39)40(48-42)46-28(3)27-51)32-14-12-29(13-15-32)31-23-35(41(52)43-25-31)38-24-30-9-6-7-10-37(30)47-38/h6-19,22-26,28,47,51H,4-5,20-21,27H2,1-3H3,(H,43,52)(H,44,46,48)/q-1/t28-/m1/s1.
What are the key properties of CID 167052191?
CID 167052191 has a molecular weight of 771.99 g/mol, XLogP of 8.82, 15 rotatable bonds, 4 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for CID 167052191 is sourced from PubChem (CID 167052191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).