C27H32ClN5O4 — CID 167052566
(6R,7S)-3-(3-chloro-2-methoxyanilino)-6,7-dimethyl-2-[3-[[(2R)-4-methylmorpholin-2-yl]methoxy]-4-pyridinyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one (PubChem CID 167052566) has the molecular formula C27H32ClN5O4 and a molecular weight of 526.04 g/mol. Its IUPAC name is (6R,7S)-3-(3-chloro-2-methoxyanilino)-6,7-dimethyl-2-[3-[[(2R)-4-methylmorpholin-2-yl]methoxy]-4-pyridinyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one.
| Compound Name | (6R,7S)-3-(3-chloro-2-methoxyanilino)-6,7-dimethyl-2-[3-[[(2R)-4-methylmorpholin-2-yl]methoxy]-4-pyridinyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 167052566 |
| Molecular Formula | C27H32ClN5O4 |
| Molecular Weight | 526.04 g/mol |
| Exact Mass | 525.21 |
| IUPAC Name | (6R,7S)-3-(3-chloro-2-methoxyanilino)-6,7-dimethyl-2-[3-[[(2R)-4-methylmorpholin-2-yl]methoxy]-4-pyridinyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one |
| SMILES | COc1c(Cl)cccc1Nc1c(-c2ccncc2OC[C@H]2CN(C)CCO2)[nH]c2c1C(=O)N[C@H](C)[C@@H]2C |
| InChI | InChI=1S/C27H32ClN5O4/c1-15-16(2)30-27(34)22-23(15)32-24(25(22)31-20-7-5-6-19(28)26(20)35-4)18-8-9-29-12-21(18)37-14-17-13-33(3)10-11-36-17/h5-9,12,15-17,31-32H,10-11,13-14H2,1-4H3,(H,30,34)/t15-,16+,17+/m0/s1 |
| InChIKey | CJWSAMUWHWFWSK-GVDBMIGSSA-N |
| XLogP | 4.43 |
| TPSA | 100.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.04 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |