C16H16N4O — CID 167052643
1-N-(6-methoxy-3-pyridinyl)-6-methylisoquinoline-1,5-diamine (PubChem CID 167052643) has the molecular formula C16H16N4O and a molecular weight of 280.33 g/mol. Its IUPAC name is 1-N-(6-methoxy-3-pyridinyl)-6-methylisoquinoline-1,5-diamine.
| Compound Name | 1-N-(6-methoxy-3-pyridinyl)-6-methylisoquinoline-1,5-diamine |
|---|---|
| PubChem CID | 167052643 |
| Molecular Formula | C16H16N4O |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 1-N-(6-methoxy-3-pyridinyl)-6-methylisoquinoline-1,5-diamine |
| SMILES | COc1ccc(Nc2nccc3c(N)c(C)ccc23)cn1 |
| InChI | InChI=1S/C16H16N4O/c1-10-3-5-13-12(15(10)17)7-8-18-16(13)20-11-4-6-14(21-2)19-9-11/h3-9H,17H2,1-2H3,(H,18,20) |
| InChIKey | RXDCUKODTDZOPP-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|