About tert-butyl N-[[1-(4,4,4-trifluorobutyl)pyrazol-4-yl]methyl]carbamate
tert-butyl N-[[1-(4,4,4-trifluorobutyl)pyrazol-4-yl]methyl]carbamate (PubChem CID 167052908) has the molecular formula C13H20F3N3O2
and a molecular weight of 307.32 g/mol. Its IUPAC name is tert-butyl N-[[1-(4,4,4-trifluorobutyl)pyrazol-4-yl]methyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[[1-(4,4,4-trifluorobutyl)pyrazol-4-yl]methyl]carbamate |
| PubChem CID | 167052908 |
| Molecular Formula | C13H20F3N3O2 |
| Molecular Weight | 307.32 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | tert-butyl N-[[1-(4,4,4-trifluorobutyl)pyrazol-4-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cnn(CCCC(F)(F)F)c1 |
| InChI | InChI=1S/C13H20F3N3O2/c1-12(2,3)21-11(20)17-7-10-8-18-19(9-10)6-4-5-13(14,15)16/h8-9H,4-7H2,1-3H3,(H,17,20) |
| InChIKey | AFVSNWZZBNMFSZ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.32 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl N-[[1-(4,4,4-trifluorobutyl)pyrazol-4-yl]methyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[[1-(4,4,4-trifluorobutyl)pyrazol-4-yl]methyl]carbamate?
The IUPAC name of tert-butyl N-[[1-(4,4,4-trifluorobutyl)pyrazol-4-yl]methyl]carbamate (CID 167052908) is tert-butyl N-[[1-(4,4,4-trifluorobutyl)pyrazol-4-yl]methyl]carbamate.
What is the SMILES notation for tert-butyl N-[[1-(4,4,4-trifluorobutyl)pyrazol-4-yl]methyl]carbamate?
The canonical SMILES for tert-butyl N-[[1-(4,4,4-trifluorobutyl)pyrazol-4-yl]methyl]carbamate is CC(C)(C)OC(=O)NCc1cnn(CCCC(F)(F)F)c1.
What is the InChIKey of tert-butyl N-[[1-(4,4,4-trifluorobutyl)pyrazol-4-yl]methyl]carbamate?
The InChIKey is AFVSNWZZBNMFSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20F3N3O2/c1-12(2,3)21-11(20)17-7-10-8-18-19(9-10)6-4-5-13(14,15)16/h8-9H,4-7H2,1-3H3,(H,17,20).
What are the key properties of tert-butyl N-[[1-(4,4,4-trifluorobutyl)pyrazol-4-yl]methyl]carbamate?
tert-butyl N-[[1-(4,4,4-trifluorobutyl)pyrazol-4-yl]methyl]carbamate has a molecular weight of 307.32 g/mol, XLogP of 3.25, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[[1-(4,4,4-trifluorobutyl)pyrazol-4-yl]methyl]carbamate is sourced from PubChem (CID 167052908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).