C22H24ClN7O — CID 167052915
(3S)-7-[[1-[(4-chlorophenyl)methyl]pyrazol-4-yl]methylamino]-3,4-dimethyl-1,4,6,8-tetrazatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-2-one (PubChem CID 167052915) has the molecular formula C22H24ClN7O and a molecular weight of 437.94 g/mol. Its IUPAC name is (3S)-7-[[1-[(4-chlorophenyl)methyl]pyrazol-4-yl]methylamino]-3,4-dimethyl-1,4,6,8-tetrazatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-2-one.
| Compound Name | (3S)-7-[[1-[(4-chlorophenyl)methyl]pyrazol-4-yl]methylamino]-3,4-dimethyl-1,4,6,8-tetrazatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-2-one |
|---|---|
| PubChem CID | 167052915 |
| Molecular Formula | C22H24ClN7O |
| Molecular Weight | 437.94 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | (3S)-7-[[1-[(4-chlorophenyl)methyl]pyrazol-4-yl]methylamino]-3,4-dimethyl-1,4,6,8-tetrazatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-2-one |
| SMILES | C[C@H]1C(=O)N2CCCc3nc(NCc4cnn(Cc5ccc(Cl)cc5)c4)nc(c32)N1C |
| InChI | InChI=1S/C22H24ClN7O/c1-14-21(31)30-9-3-4-18-19(30)20(28(14)2)27-22(26-18)24-10-16-11-25-29(13-16)12-15-5-7-17(23)8-6-15/h5-8,11,13-14H,3-4,9-10,12H2,1-2H3,(H,24,26,27)/t14-/m0/s1 |
| InChIKey | CSWHQAKUNMRMRP-AWEZNQCLSA-N |
| XLogP | 3.10 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.94 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |