C10H13F3N2 — CID 167053063
(2Z)-1,1,1-trifluoro-N-methyl-N-[(Z)-1-(methylideneamino)prop-1-en-2-yl]penta-2,4-dien-2-amine (PubChem CID 167053063) has the molecular formula C10H13F3N2 and a molecular weight of 218.22 g/mol. Its IUPAC name is (2Z)-1,1,1-trifluoro-N-methyl-N-[(Z)-1-(methylideneamino)prop-1-en-2-yl]penta-2,4-dien-2-amine.
| Compound Name | (2Z)-1,1,1-trifluoro-N-methyl-N-[(Z)-1-(methylideneamino)prop-1-en-2-yl]penta-2,4-dien-2-amine |
|---|---|
| PubChem CID | 167053063 |
| Molecular Formula | C10H13F3N2 |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.10 |
| IUPAC Name | (2Z)-1,1,1-trifluoro-N-methyl-N-[(Z)-1-(methylideneamino)prop-1-en-2-yl]penta-2,4-dien-2-amine |
| SMILES | C=C/C=C(\N(C)/C(C)=C\N=C)C(F)(F)F |
| InChI | InChI=1S/C10H13F3N2/c1-5-6-9(10(11,12)13)15(4)8(2)7-14-3/h5-7H,1,3H2,2,4H3/b8-7-,9-6- |
| InChIKey | IHABUIKEPXSYFH-QOCNPQIPSA-N |
| XLogP | 3.11 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|