C16H18F3N7 — CID 167053339
(10S)-9,10-dimethyl-N-[[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]methyl]-1,5,7,9-tetrazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-6-amine (PubChem CID 167053339) has the molecular formula C16H18F3N7 and a molecular weight of 365.36 g/mol. Its IUPAC name is (10S)-9,10-dimethyl-N-[[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]methyl]-1,5,7,9-tetrazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-6-amine.
| Compound Name | (10S)-9,10-dimethyl-N-[[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]methyl]-1,5,7,9-tetrazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-6-amine |
|---|---|
| PubChem CID | 167053339 |
| Molecular Formula | C16H18F3N7 |
| Molecular Weight | 365.36 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | (10S)-9,10-dimethyl-N-[[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]methyl]-1,5,7,9-tetrazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-6-amine |
| SMILES | C[C@H]1Cn2ccc3nc(NCc4cnn(CC(F)(F)F)c4)nc(c32)N1C |
| InChI | InChI=1S/C16H18F3N7/c1-10-7-25-4-3-12-13(25)14(24(10)2)23-15(22-12)20-5-11-6-21-26(8-11)9-16(17,18)19/h3-4,6,8,10H,5,7,9H2,1-2H3,(H,20,22,23)/t10-/m0/s1 |
| InChIKey | ZTCGDPYFMZITPL-JTQLQIEISA-N |
| XLogP | 2.64 |
| TPSA | 63.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.36 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |