C16H28N4O4 — CID 167054675
3,6,9,12-tetramethyl-1-(2-methylpropyl)-1,4,7,10-tetrazacyclododecane-2,5,8,11-tetrone (PubChem CID 167054675) has the molecular formula C16H28N4O4 and a molecular weight of 340.42 g/mol. Its IUPAC name is 3,6,9,12-tetramethyl-1-(2-methylpropyl)-1,4,7,10-tetrazacyclododecane-2,5,8,11-tetrone.
| Compound Name | 3,6,9,12-tetramethyl-1-(2-methylpropyl)-1,4,7,10-tetrazacyclododecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 167054675 |
| Molecular Formula | C16H28N4O4 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | 3,6,9,12-tetramethyl-1-(2-methylpropyl)-1,4,7,10-tetrazacyclododecane-2,5,8,11-tetrone |
| SMILES | CC(C)CN1C(=O)C(C)NC(=O)C(C)NC(=O)C(C)NC(=O)C1C |
| InChI | InChI=1S/C16H28N4O4/c1-8(2)7-20-12(6)15(23)18-10(4)13(21)17-9(3)14(22)19-11(5)16(20)24/h8-12H,7H2,1-6H3,(H,17,21)(H,18,23)(H,19,22) |
| InChIKey | WMAVZUWKKRLYLX-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |