C19H22FN3O — CID 167054779
4-[3-fluoro-4-[(2Z,4Z,6E)-1-imino-5-methylocta-2,4,6-trien-4-yl]phenyl]-4-iminobutanamide (PubChem CID 167054779) has the molecular formula C19H22FN3O and a molecular weight of 327.40 g/mol. Its IUPAC name is 4-[3-fluoro-4-[(2Z,4Z,6E)-1-imino-5-methylocta-2,4,6-trien-4-yl]phenyl]-4-iminobutanamide.
| Compound Name | 4-[3-fluoro-4-[(2Z,4Z,6E)-1-imino-5-methylocta-2,4,6-trien-4-yl]phenyl]-4-iminobutanamide |
|---|---|
| PubChem CID | 167054779 |
| Molecular Formula | C19H22FN3O |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | 4-[3-fluoro-4-[(2Z,4Z,6E)-1-imino-5-methylocta-2,4,6-trien-4-yl]phenyl]-4-iminobutanamide |
| SMILES | [H]/N=C\C=C/C(=C(C)/C=C/C)c1ccc(/C(CCC(N)=O)=N/[H])cc1F |
| InChI | InChI=1S/C19H22FN3O/c1-3-5-13(2)15(6-4-11-21)16-8-7-14(12-17(16)20)18(22)9-10-19(23)24/h3-8,11-12,21-22H,9-10H2,1-2H3,(H2,23,24)/b5-3+,6-4-,15-13-,21-11-,22-18+ |
| InChIKey | ARJOTCUOIQYOBI-MDJCGHRDSA-N |
| XLogP | 4.01 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|