C10H8N4O2 — CID 167054962
2,7-diamino-1,8-dihydropyrrolo[3,2-g]indole-4,5-dione (PubChem CID 167054962) has the molecular formula C10H8N4O2 and a molecular weight of 216.20 g/mol. Its IUPAC name is 2,7-diamino-1,8-dihydropyrrolo[3,2-g]indole-4,5-dione.
| Compound Name | 2,7-diamino-1,8-dihydropyrrolo[3,2-g]indole-4,5-dione |
|---|---|
| PubChem CID | 167054962 |
| Molecular Formula | C10H8N4O2 |
| Molecular Weight | 216.20 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | 2,7-diamino-1,8-dihydropyrrolo[3,2-g]indole-4,5-dione |
| SMILES | Nc1cc2c([nH]1)-c1[nH]c(N)cc1C(=O)C2=O |
| InChI | InChI=1S/C10H8N4O2/c11-5-1-3-7(13-5)8-4(2-6(12)14-8)10(16)9(3)15/h1-2,13-14H,11-12H2 |
| InChIKey | YSPJKGJFGUNION-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 117.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.20 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|