About N-[(5-fluoro-2,3-dihydro-1H-inden-4-yl)methyl]-4-methylaniline
N-[(5-fluoro-2,3-dihydro-1H-inden-4-yl)methyl]-4-methylaniline (PubChem CID 167055520) has the molecular formula C17H18FN
and a molecular weight of 255.34 g/mol. Its IUPAC name is N-[(5-fluoro-2,3-dihydro-1H-inden-4-yl)methyl]-4-methylaniline.
Molecular Properties
| Compound Name | N-[(5-fluoro-2,3-dihydro-1H-inden-4-yl)methyl]-4-methylaniline |
| PubChem CID | 167055520 |
| Molecular Formula | C17H18FN |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | N-[(5-fluoro-2,3-dihydro-1H-inden-4-yl)methyl]-4-methylaniline |
| SMILES | Cc1ccc(NCc2c(F)ccc3c2CCC3)cc1 |
| InChI | InChI=1S/C17H18FN/c1-12-5-8-14(9-6-12)19-11-16-15-4-2-3-13(15)7-10-17(16)18/h5-10,19H,2-4,11H2,1H3 |
| InChIKey | JGNOQUNFIWFRNV-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[(5-fluoro-2,3-dihydro-1H-inden-4-yl)methyl]-4-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5-fluoro-2,3-dihydro-1H-inden-4-yl)methyl]-4-methylaniline?
The IUPAC name of N-[(5-fluoro-2,3-dihydro-1H-inden-4-yl)methyl]-4-methylaniline (CID 167055520) is N-[(5-fluoro-2,3-dihydro-1H-inden-4-yl)methyl]-4-methylaniline.
What is the SMILES notation for N-[(5-fluoro-2,3-dihydro-1H-inden-4-yl)methyl]-4-methylaniline?
The canonical SMILES for N-[(5-fluoro-2,3-dihydro-1H-inden-4-yl)methyl]-4-methylaniline is Cc1ccc(NCc2c(F)ccc3c2CCC3)cc1.
What is the InChIKey of N-[(5-fluoro-2,3-dihydro-1H-inden-4-yl)methyl]-4-methylaniline?
The InChIKey is JGNOQUNFIWFRNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18FN/c1-12-5-8-14(9-6-12)19-11-16-15-4-2-3-13(15)7-10-17(16)18/h5-10,19H,2-4,11H2,1H3.
What are the key properties of N-[(5-fluoro-2,3-dihydro-1H-inden-4-yl)methyl]-4-methylaniline?
N-[(5-fluoro-2,3-dihydro-1H-inden-4-yl)methyl]-4-methylaniline has a molecular weight of 255.34 g/mol, XLogP of 4.23, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5-fluoro-2,3-dihydro-1H-inden-4-yl)methyl]-4-methylaniline is sourced from PubChem (CID 167055520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).