C24H29N3O3 — CID 167055680
[3-(1,3,4,7,8,9-hexahydropyrido[3,4-b]indol-2-yl)-2-hydroxypropyl] 3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 167055680) has the molecular formula C24H29N3O3 and a molecular weight of 407.51 g/mol. Its IUPAC name is [3-(1,3,4,7,8,9-hexahydropyrido[3,4-b]indol-2-yl)-2-hydroxypropyl] 3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | [3-(1,3,4,7,8,9-hexahydropyrido[3,4-b]indol-2-yl)-2-hydroxypropyl] 3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 167055680 |
| Molecular Formula | C24H29N3O3 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | [3-(1,3,4,7,8,9-hexahydropyrido[3,4-b]indol-2-yl)-2-hydroxypropyl] 3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | O=C(OCC(O)CN1CCc2c([nH]c3c2C=CCC3)C1)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C24H29N3O3/c28-19(16-30-24(29)27-12-9-17-5-1-2-6-18(17)13-27)14-26-11-10-21-20-7-3-4-8-22(20)25-23(21)15-26/h1-3,5-7,19,25,28H,4,8-16H2 |
| InChIKey | CQZUEQGDCBICCA-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 68.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |