C19H36NO+ — CID 167055850
butyl-ethyl-[2-[(3Z,5Z)-2-methylidenehepta-3,5-dienoxy]ethyl]-propylazanium (PubChem CID 167055850) has the molecular formula C19H36NO+ and a molecular weight of 294.50 g/mol. Its IUPAC name is butyl-ethyl-[2-[(3Z,5Z)-2-methylidenehepta-3,5-dienoxy]ethyl]-propylazanium.
| Compound Name | butyl-ethyl-[2-[(3Z,5Z)-2-methylidenehepta-3,5-dienoxy]ethyl]-propylazanium |
|---|---|
| PubChem CID | 167055850 |
| Molecular Formula | C19H36NO+ |
| Molecular Weight | 294.50 g/mol |
| Exact Mass | 294.28 |
| IUPAC Name | butyl-ethyl-[2-[(3Z,5Z)-2-methylidenehepta-3,5-dienoxy]ethyl]-propylazanium |
| SMILES | C=C(/C=C\C=C/C)COCC[N+](CC)(CCC)CCCC |
| InChI | InChI=1S/C19H36NO/c1-6-10-12-13-19(5)18-21-17-16-20(9-4,14-8-3)15-11-7-2/h6,10,12-13H,5,7-9,11,14-18H2,1-4H3/q+1/b10-6-,13-12- |
| InChIKey | QCNVHMULHZWODJ-IEMYJEBPSA-N |
| XLogP | 4.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.50 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|