C13H16F6O2 — CID 167055857
2-[(6-ethyl-4-methylcyclohexa-1,5-dien-1-yl)oxymethyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 167055857) has the molecular formula C13H16F6O2 and a molecular weight of 318.26 g/mol. Its IUPAC name is 2-[(6-ethyl-4-methylcyclohexa-1,5-dien-1-yl)oxymethyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[(6-ethyl-4-methylcyclohexa-1,5-dien-1-yl)oxymethyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 167055857 |
| Molecular Formula | C13H16F6O2 |
| Molecular Weight | 318.26 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 2-[(6-ethyl-4-methylcyclohexa-1,5-dien-1-yl)oxymethyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CCC1=CC(C)CC=C1OCC(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H16F6O2/c1-3-9-6-8(2)4-5-10(9)21-7-11(20,12(14,15)16)13(17,18)19/h5-6,8,20H,3-4,7H2,1-2H3 |
| InChIKey | AOFHIBRKPXOSJF-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.26 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |