C16H24F2N2 — CID 167055985
N-[(3Z)-3-[C-(difluoromethyl)-N-methylcarbonimidoyl]-5-methylhexa-1,3,5-trien-2-yl]cyclohexanamine (PubChem CID 167055985) has the molecular formula C16H24F2N2 and a molecular weight of 282.38 g/mol. Its IUPAC name is N-[(3Z)-3-[C-(difluoromethyl)-N-methylcarbonimidoyl]-5-methylhexa-1,3,5-trien-2-yl]cyclohexanamine.
| Compound Name | N-[(3Z)-3-[C-(difluoromethyl)-N-methylcarbonimidoyl]-5-methylhexa-1,3,5-trien-2-yl]cyclohexanamine |
|---|---|
| PubChem CID | 167055985 |
| Molecular Formula | C16H24F2N2 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | N-[(3Z)-3-[C-(difluoromethyl)-N-methylcarbonimidoyl]-5-methylhexa-1,3,5-trien-2-yl]cyclohexanamine |
| SMILES | C=C(C)/C=C(C(=C)NC1CCCCC1)\C(=N\C)C(F)F |
| InChI | InChI=1S/C16H24F2N2/c1-11(2)10-14(15(19-4)16(17)18)12(3)20-13-8-6-5-7-9-13/h10,13,16,20H,1,3,5-9H2,2,4H3/b14-10-,19-15- |
| InChIKey | ZSGKTVQATFVGJX-XECRZQDUSA-N |
| XLogP | 4.26 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|