C15H26N2 — CID 167056874
(E)-N,N,3-trimethyl-4-(5-methylhexa-1,5-dien-2-ylimino)pent-2-en-2-amine (PubChem CID 167056874) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is (E)-N,N,3-trimethyl-4-(5-methylhexa-1,5-dien-2-ylimino)pent-2-en-2-amine.
| Compound Name | (E)-N,N,3-trimethyl-4-(5-methylhexa-1,5-dien-2-ylimino)pent-2-en-2-amine |
|---|---|
| PubChem CID | 167056874 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | (E)-N,N,3-trimethyl-4-(5-methylhexa-1,5-dien-2-ylimino)pent-2-en-2-amine |
| SMILES | C=C(C)CCC(=C)/N=C(C)/C(C)=C(\C)N(C)C |
| InChI | InChI=1S/C15H26N2/c1-11(2)9-10-12(3)16-14(5)13(4)15(6)17(7)8/h1,3,9-10H2,2,4-8H3/b15-13+,16-14+ |
| InChIKey | MVDBFFRWEDUAGJ-WXUKJITCSA-N |
| XLogP | 4.17 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|