C17H35NO — CID 167056970
6-tert-butyl-1-hydroxy-2,2,3,5,8,8-hexamethylazocane (PubChem CID 167056970) has the molecular formula C17H35NO and a molecular weight of 269.47 g/mol. Its IUPAC name is 6-tert-butyl-1-hydroxy-2,2,3,5,8,8-hexamethylazocane.
| Compound Name | 6-tert-butyl-1-hydroxy-2,2,3,5,8,8-hexamethylazocane |
|---|---|
| PubChem CID | 167056970 |
| Molecular Formula | C17H35NO |
| Molecular Weight | 269.47 g/mol |
| Exact Mass | 269.27 |
| IUPAC Name | 6-tert-butyl-1-hydroxy-2,2,3,5,8,8-hexamethylazocane |
| SMILES | CC1CC(C)C(C)(C)N(O)C(C)(C)CC1C(C)(C)C |
| InChI | InChI=1S/C17H35NO/c1-12-10-13(2)17(8,9)18(19)16(6,7)11-14(12)15(3,4)5/h12-14,19H,10-11H2,1-9H3 |
| InChIKey | GDEJUSYRXDCEHX-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.47 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |