C24H26Cl2N4O3 — CID 167057626
2-[3,5-dichloro-4-[(7-methyl-1-methylidene-2,5,6,7-tetrahydrocyclopenta[c]pyridin-4-yl)oxy]phenyl]-6-(2-methylbutan-2-yl)-1,2,4-triazine-3,5-dione (PubChem CID 167057626) has the molecular formula C24H26Cl2N4O3 and a molecular weight of 489.40 g/mol. Its IUPAC name is 2-[3,5-dichloro-4-[(7-methyl-1-methylidene-2,5,6,7-tetrahydrocyclopenta[c]pyridin-4-yl)oxy]phenyl]-6-(2-methylbutan-2-yl)-1,2,4-triazine-3,5-dione.
| Compound Name | 2-[3,5-dichloro-4-[(7-methyl-1-methylidene-2,5,6,7-tetrahydrocyclopenta[c]pyridin-4-yl)oxy]phenyl]-6-(2-methylbutan-2-yl)-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 167057626 |
| Molecular Formula | C24H26Cl2N4O3 |
| Molecular Weight | 489.40 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | 2-[3,5-dichloro-4-[(7-methyl-1-methylidene-2,5,6,7-tetrahydrocyclopenta[c]pyridin-4-yl)oxy]phenyl]-6-(2-methylbutan-2-yl)-1,2,4-triazine-3,5-dione |
| SMILES | C=C1NC=C(Oc2c(Cl)cc(-n3nc(C(C)(C)CC)c(=O)[nH]c3=O)cc2Cl)C2=C1C(C)CC2 |
| InChI | InChI=1S/C24H26Cl2N4O3/c1-6-24(4,5)21-22(31)28-23(32)30(29-21)14-9-16(25)20(17(26)10-14)33-18-11-27-13(3)19-12(2)7-8-15(18)19/h9-12,27H,3,6-8H2,1-2,4-5H3,(H,28,31,32) |
| InChIKey | OMIXBKFVGQXIHX-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 89.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.40 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |