C25H20F6N2O3 — CID 167058038
1'-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]methyl]spiro[3,5-dihydrofuro[3,2-c]pyridine-2,3'-azetidine]-6-one (PubChem CID 167058038) has the molecular formula C25H20F6N2O3 and a molecular weight of 510.43 g/mol. Its IUPAC name is 1'-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]methyl]spiro[3,5-dihydrofuro[3,2-c]pyridine-2,3'-azetidine]-6-one.
| Compound Name | 1'-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]methyl]spiro[3,5-dihydrofuro[3,2-c]pyridine-2,3'-azetidine]-6-one |
|---|---|
| PubChem CID | 167058038 |
| Molecular Formula | C25H20F6N2O3 |
| Molecular Weight | 510.43 g/mol |
| Exact Mass | 510.14 |
| IUPAC Name | 1'-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]methyl]spiro[3,5-dihydrofuro[3,2-c]pyridine-2,3'-azetidine]-6-one |
| SMILES | O=c1cc2c(c[nH]1)CC1(CN(Cc3ccc(-c4ccc(C(O)(C(F)(F)F)C(F)(F)F)cc4)cc3)C1)O2 |
| InChI | InChI=1S/C25H20F6N2O3/c26-24(27,28)23(35,25(29,30)31)19-7-5-17(6-8-19)16-3-1-15(2-4-16)12-33-13-22(14-33)10-18-11-32-21(34)9-20(18)36-22/h1-9,11,35H,10,12-14H2,(H,32,34) |
| InChIKey | SNZZZOQDBUIKKZ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 65.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.43 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |