About 4-fluorospiro[3H-furo[2,3-c]pyridine-2,4'-piperidine]
4-fluorospiro[3H-furo[2,3-c]pyridine-2,4'-piperidine] (PubChem CID 167058054) has the molecular formula C11H13FN2O
and a molecular weight of 208.24 g/mol. Its IUPAC name is 4-fluorospiro[3H-furo[2,3-c]pyridine-2,4'-piperidine].
Molecular Properties
| Compound Name | 4-fluorospiro[3H-furo[2,3-c]pyridine-2,4'-piperidine] |
| PubChem CID | 167058054 |
| Molecular Formula | C11H13FN2O |
| Molecular Weight | 208.24 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 4-fluorospiro[3H-furo[2,3-c]pyridine-2,4'-piperidine] |
| SMILES | Fc1cncc2c1CC1(CCNCC1)O2 |
| InChI | InChI=1S/C11H13FN2O/c12-9-6-14-7-10-8(9)5-11(15-10)1-3-13-4-2-11/h6-7,13H,1-5H2 |
| InChIKey | PNLXWRFVDYHPMP-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.24 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-fluorospiro[3H-furo[2,3-c]pyridine-2,4'-piperidine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluorospiro[3H-furo[2,3-c]pyridine-2,4'-piperidine]?
The IUPAC name of 4-fluorospiro[3H-furo[2,3-c]pyridine-2,4'-piperidine] (CID 167058054) is 4-fluorospiro[3H-furo[2,3-c]pyridine-2,4'-piperidine].
What is the SMILES notation for 4-fluorospiro[3H-furo[2,3-c]pyridine-2,4'-piperidine]?
The canonical SMILES for 4-fluorospiro[3H-furo[2,3-c]pyridine-2,4'-piperidine] is Fc1cncc2c1CC1(CCNCC1)O2.
What is the InChIKey of 4-fluorospiro[3H-furo[2,3-c]pyridine-2,4'-piperidine]?
The InChIKey is PNLXWRFVDYHPMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13FN2O/c12-9-6-14-7-10-8(9)5-11(15-10)1-3-13-4-2-11/h6-7,13H,1-5H2.
What are the key properties of 4-fluorospiro[3H-furo[2,3-c]pyridine-2,4'-piperidine]?
4-fluorospiro[3H-furo[2,3-c]pyridine-2,4'-piperidine] has a molecular weight of 208.24 g/mol, XLogP of 1.28, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluorospiro[3H-furo[2,3-c]pyridine-2,4'-piperidine] is sourced from PubChem (CID 167058054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).