C20H11F11O9S — CID 167058096
1,1-difluoro-2-oxo-2-[[5-oxo-9-[2,4,6-tris(trifluoromethyl)phenoxy]carbonyl-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]ethanesulfonic acid (PubChem CID 167058096) has the molecular formula C20H11F11O9S and a molecular weight of 636.34 g/mol. Its IUPAC name is 1,1-difluoro-2-oxo-2-[[5-oxo-9-[2,4,6-tris(trifluoromethyl)phenoxy]carbonyl-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]ethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-oxo-2-[[5-oxo-9-[2,4,6-tris(trifluoromethyl)phenoxy]carbonyl-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]ethanesulfonic acid |
|---|---|
| PubChem CID | 167058096 |
| Molecular Formula | C20H11F11O9S |
| Molecular Weight | 636.34 g/mol |
| Exact Mass | 635.99 |
| IUPAC Name | 1,1-difluoro-2-oxo-2-[[5-oxo-9-[2,4,6-tris(trifluoromethyl)phenoxy]carbonyl-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]ethanesulfonic acid |
| SMILES | O=C1OC2C3CC(C2OC(=O)C(F)(F)S(=O)(=O)O)C(C(=O)Oc2c(C(F)(F)F)cc(C(F)(F)F)cc2C(F)(F)F)C13 |
| InChI | InChI=1S/C20H11F11O9S/c21-17(22,23)4-1-7(18(24,25)26)13(8(2-4)19(27,28)29)39-15(33)10-6-3-5-9(10)14(32)38-11(5)12(6)40-16(34)20(30,31)41(35,36)37/h1-2,5-6,9-12H,3H2,(H,35,36,37) |
| InChIKey | KAPNFDDECXJZGJ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.34 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|