C19H14F5IO10S — CID 167058146
1,1,3,3,3-pentafluoro-2-[2-(4-iodophenoxy)carbonyloxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carbonyl]oxypropane-1-sulfonic acid (PubChem CID 167058146) has the molecular formula C19H14F5IO10S and a molecular weight of 656.27 g/mol. Its IUPAC name is 1,1,3,3,3-pentafluoro-2-[2-(4-iodophenoxy)carbonyloxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carbonyl]oxypropane-1-sulfonic acid.
| Compound Name | 1,1,3,3,3-pentafluoro-2-[2-(4-iodophenoxy)carbonyloxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carbonyl]oxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 167058146 |
| Molecular Formula | C19H14F5IO10S |
| Molecular Weight | 656.27 g/mol |
| Exact Mass | 655.93 |
| IUPAC Name | 1,1,3,3,3-pentafluoro-2-[2-(4-iodophenoxy)carbonyloxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carbonyl]oxypropane-1-sulfonic acid |
| SMILES | O=C(Oc1ccc(I)cc1)OC1C2CC3C1OC(=O)C3C2C(=O)OC(C(F)(F)F)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C19H14F5IO10S/c20-18(21,22)16(19(23,24)36(29,30)31)35-15(27)11-9-5-8-10(11)14(26)33-12(8)13(9)34-17(28)32-7-3-1-6(25)2-4-7/h1-4,8-13,16H,5H2,(H,29,30,31) |
| InChIKey | KCXOPEIDEUTBJF-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 142.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.27 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|