C19H15F2I3O9S — CID 167058154
1,1-difluoro-2-oxo-2-[[5-oxo-9-(2,4,5-triiodo-3,6-dimethylphenoxy)carbonyl-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]ethanesulfonic acid (PubChem CID 167058154) has the molecular formula C19H15F2I3O9S and a molecular weight of 838.09 g/mol. Its IUPAC name is 1,1-difluoro-2-oxo-2-[[5-oxo-9-(2,4,5-triiodo-3,6-dimethylphenoxy)carbonyl-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]ethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-oxo-2-[[5-oxo-9-(2,4,5-triiodo-3,6-dimethylphenoxy)carbonyl-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]ethanesulfonic acid |
|---|---|
| PubChem CID | 167058154 |
| Molecular Formula | C19H15F2I3O9S |
| Molecular Weight | 838.09 g/mol |
| Exact Mass | 837.75 |
| IUPAC Name | 1,1-difluoro-2-oxo-2-[[5-oxo-9-(2,4,5-triiodo-3,6-dimethylphenoxy)carbonyl-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]ethanesulfonic acid |
| SMILES | Cc1c(I)c(I)c(C)c(OC(=O)C2C3CC4C(OC(=O)C42)C3OC(=O)C(F)(F)S(=O)(=O)O)c1I |
| InChI | InChI=1S/C19H15F2I3O9S/c1-4-10(22)11(23)5(2)13(12(4)24)31-16(25)9-7-3-6-8(9)17(26)32-14(6)15(7)33-18(27)19(20,21)34(28,29)30/h6-9,14-15H,3H2,1-2H3,(H,28,29,30) |
| InChIKey | WPOAUHKNVZQOJS-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.09 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|