C17H13F2IO9S — CID 167058232
1,1-difluoro-2-[[9-(3-iodophenoxy)carbonyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-2-oxoethanesulfonic acid (PubChem CID 167058232) has the molecular formula C17H13F2IO9S and a molecular weight of 558.25 g/mol. Its IUPAC name is 1,1-difluoro-2-[[9-(3-iodophenoxy)carbonyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-2-oxoethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[[9-(3-iodophenoxy)carbonyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 167058232 |
| Molecular Formula | C17H13F2IO9S |
| Molecular Weight | 558.25 g/mol |
| Exact Mass | 557.93 |
| IUPAC Name | 1,1-difluoro-2-[[9-(3-iodophenoxy)carbonyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-2-oxoethanesulfonic acid |
| SMILES | O=C1OC2C3CC(C2OC(=O)C(F)(F)S(=O)(=O)O)C(C(=O)Oc2cccc(I)c2)C13 |
| InChI | InChI=1S/C17H13F2IO9S/c18-17(19,30(24,25)26)16(23)29-13-9-5-8-11(15(22)28-12(8)13)10(9)14(21)27-7-3-1-2-6(20)4-7/h1-4,8-13H,5H2,(H,24,25,26) |
| InChIKey | BGEUEKREPIEJSH-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.25 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|