C18H16F2O9S — CID 167058233
1,1-difluoro-2-[[9-(2-methylphenoxy)carbonyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-2-oxoethanesulfonic acid (PubChem CID 167058233) has the molecular formula C18H16F2O9S and a molecular weight of 446.38 g/mol. Its IUPAC name is 1,1-difluoro-2-[[9-(2-methylphenoxy)carbonyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-2-oxoethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[[9-(2-methylphenoxy)carbonyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 167058233 |
| Molecular Formula | C18H16F2O9S |
| Molecular Weight | 446.38 g/mol |
| Exact Mass | 446.05 |
| IUPAC Name | 1,1-difluoro-2-[[9-(2-methylphenoxy)carbonyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-2-oxoethanesulfonic acid |
| SMILES | Cc1ccccc1OC(=O)C1C2CC3C(OC(=O)C31)C2OC(=O)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C18H16F2O9S/c1-7-4-2-3-5-10(7)27-15(21)11-9-6-8-12(11)16(22)28-13(8)14(9)29-17(23)18(19,20)30(24,25)26/h2-5,8-9,11-14H,6H2,1H3,(H,24,25,26) |
| InChIKey | YBYPHUMOEFJEPB-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.38 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|