C17H12F2I2O10S — CID 167058310
1,1-difluoro-2-[[9-(4-hydroxy-3,5-diiodophenoxy)carbonyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-2-oxoethanesulfonic acid (PubChem CID 167058310) has the molecular formula C17H12F2I2O10S and a molecular weight of 700.14 g/mol. Its IUPAC name is 1,1-difluoro-2-[[9-(4-hydroxy-3,5-diiodophenoxy)carbonyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-2-oxoethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[[9-(4-hydroxy-3,5-diiodophenoxy)carbonyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 167058310 |
| Molecular Formula | C17H12F2I2O10S |
| Molecular Weight | 700.14 g/mol |
| Exact Mass | 699.82 |
| IUPAC Name | 1,1-difluoro-2-[[9-(4-hydroxy-3,5-diiodophenoxy)carbonyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-2-oxoethanesulfonic acid |
| SMILES | O=C1OC2C3CC(C2OC(=O)C(F)(F)S(=O)(=O)O)C(C(=O)Oc2cc(I)c(O)c(I)c2)C13 |
| InChI | InChI=1S/C17H12F2I2O10S/c18-17(19,32(26,27)28)16(25)31-13-6-3-5-10(15(24)30-12(5)13)9(6)14(23)29-4-1-7(20)11(22)8(21)2-4/h1-2,5-6,9-10,12-13,22H,3H2,(H,26,27,28) |
| InChIKey | NIGZEMYLCFDIGO-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 153.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.14 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|