About (E)-N-[(2-butyl-4,5-dihydro-1H-imidazol-5-yl)methyl]hex-3-en-3-amine
(E)-N-[(2-butyl-4,5-dihydro-1H-imidazol-5-yl)methyl]hex-3-en-3-amine (PubChem CID 167058425) has the molecular formula C14H27N3
and a molecular weight of 237.39 g/mol. Its IUPAC name is (E)-N-[(2-butyl-4,5-dihydro-1H-imidazol-5-yl)methyl]hex-3-en-3-amine.
Molecular Properties
| Compound Name | (E)-N-[(2-butyl-4,5-dihydro-1H-imidazol-5-yl)methyl]hex-3-en-3-amine |
| PubChem CID | 167058425 |
| Molecular Formula | C14H27N3 |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.22 |
| IUPAC Name | (E)-N-[(2-butyl-4,5-dihydro-1H-imidazol-5-yl)methyl]hex-3-en-3-amine |
| SMILES | CC/C=C(\CC)NCC1CN=C(CCCC)N1 |
| InChI | InChI=1S/C14H27N3/c1-4-7-9-14-16-11-13(17-14)10-15-12(6-3)8-5-2/h8,13,15H,4-7,9-11H2,1-3H3,(H,16,17)/b12-8+ |
| InChIKey | IZXSNWLHAFOWCT-XYOKQWHBSA-N |
| XLogP | 2.84 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (E)-N-[(2-butyl-4,5-dihydro-1H-imidazol-5-yl)methyl]hex-3-en-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-[(2-butyl-4,5-dihydro-1H-imidazol-5-yl)methyl]hex-3-en-3-amine?
The IUPAC name of (E)-N-[(2-butyl-4,5-dihydro-1H-imidazol-5-yl)methyl]hex-3-en-3-amine (CID 167058425) is (E)-N-[(2-butyl-4,5-dihydro-1H-imidazol-5-yl)methyl]hex-3-en-3-amine.
What is the SMILES notation for (E)-N-[(2-butyl-4,5-dihydro-1H-imidazol-5-yl)methyl]hex-3-en-3-amine?
The canonical SMILES for (E)-N-[(2-butyl-4,5-dihydro-1H-imidazol-5-yl)methyl]hex-3-en-3-amine is CC/C=C(\CC)NCC1CN=C(CCCC)N1.
What is the InChIKey of (E)-N-[(2-butyl-4,5-dihydro-1H-imidazol-5-yl)methyl]hex-3-en-3-amine?
The InChIKey is IZXSNWLHAFOWCT-XYOKQWHBSA-N. The full InChI is InChI=1S/C14H27N3/c1-4-7-9-14-16-11-13(17-14)10-15-12(6-3)8-5-2/h8,13,15H,4-7,9-11H2,1-3H3,(H,16,17)/b12-8+.
What are the key properties of (E)-N-[(2-butyl-4,5-dihydro-1H-imidazol-5-yl)methyl]hex-3-en-3-amine?
(E)-N-[(2-butyl-4,5-dihydro-1H-imidazol-5-yl)methyl]hex-3-en-3-amine has a molecular weight of 237.39 g/mol, XLogP of 2.84, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-[(2-butyl-4,5-dihydro-1H-imidazol-5-yl)methyl]hex-3-en-3-amine is sourced from PubChem (CID 167058425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).