C24H25FN8O — CID 167058477
4-[6-[4-(2-azidopropan-2-yl)piperidin-1-yl]pyrazolo[1,5-a]pyrimidin-3-yl]-7-fluoro-6-methoxyquinoline (PubChem CID 167058477) has the molecular formula C24H25FN8O and a molecular weight of 460.52 g/mol. Its IUPAC name is 4-[6-[4-(2-azidopropan-2-yl)piperidin-1-yl]pyrazolo[1,5-a]pyrimidin-3-yl]-7-fluoro-6-methoxyquinoline.
| Compound Name | 4-[6-[4-(2-azidopropan-2-yl)piperidin-1-yl]pyrazolo[1,5-a]pyrimidin-3-yl]-7-fluoro-6-methoxyquinoline |
|---|---|
| PubChem CID | 167058477 |
| Molecular Formula | C24H25FN8O |
| Molecular Weight | 460.52 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | 4-[6-[4-(2-azidopropan-2-yl)piperidin-1-yl]pyrazolo[1,5-a]pyrimidin-3-yl]-7-fluoro-6-methoxyquinoline |
| SMILES | COc1cc2c(-c3cnn4cc(N5CCC(C(C)(C)N=[N+]=[N-])CC5)cnc34)ccnc2cc1F |
| InChI | InChI=1S/C24H25FN8O/c1-24(2,30-31-26)15-5-8-32(9-6-15)16-12-28-23-19(13-29-33(23)14-16)17-4-7-27-21-11-20(25)22(34-3)10-18(17)21/h4,7,10-15H,5-6,8-9H2,1-3H3 |
| InChIKey | JQOQQDFOLOUYJX-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 104.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.52 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|