About 3-(1-methyl-5-pyrimidin-2-yl-1,2,4-triazol-3-yl)propanoic acid
3-(1-methyl-5-pyrimidin-2-yl-1,2,4-triazol-3-yl)propanoic acid (PubChem CID 167058591) has the molecular formula C10H11N5O2
and a molecular weight of 233.23 g/mol. Its IUPAC name is 3-(1-methyl-5-pyrimidin-2-yl-1,2,4-triazol-3-yl)propanoic acid.
Molecular Properties
| Compound Name | 3-(1-methyl-5-pyrimidin-2-yl-1,2,4-triazol-3-yl)propanoic acid |
| PubChem CID | 167058591 |
| Molecular Formula | C10H11N5O2 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | 3-(1-methyl-5-pyrimidin-2-yl-1,2,4-triazol-3-yl)propanoic acid |
| SMILES | Cn1nc(CCC(=O)O)nc1-c1ncccn1 |
| InChI | InChI=1S/C10H11N5O2/c1-15-10(9-11-5-2-6-12-9)13-7(14-15)3-4-8(16)17/h2,5-6H,3-4H2,1H3,(H,16,17) |
| InChIKey | YUYRABAKABKSJD-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(1-methyl-5-pyrimidin-2-yl-1,2,4-triazol-3-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-methyl-5-pyrimidin-2-yl-1,2,4-triazol-3-yl)propanoic acid?
The IUPAC name of 3-(1-methyl-5-pyrimidin-2-yl-1,2,4-triazol-3-yl)propanoic acid (CID 167058591) is 3-(1-methyl-5-pyrimidin-2-yl-1,2,4-triazol-3-yl)propanoic acid.
What is the SMILES notation for 3-(1-methyl-5-pyrimidin-2-yl-1,2,4-triazol-3-yl)propanoic acid?
The canonical SMILES for 3-(1-methyl-5-pyrimidin-2-yl-1,2,4-triazol-3-yl)propanoic acid is Cn1nc(CCC(=O)O)nc1-c1ncccn1.
What is the InChIKey of 3-(1-methyl-5-pyrimidin-2-yl-1,2,4-triazol-3-yl)propanoic acid?
The InChIKey is YUYRABAKABKSJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N5O2/c1-15-10(9-11-5-2-6-12-9)13-7(14-15)3-4-8(16)17/h2,5-6H,3-4H2,1H3,(H,16,17).
What are the key properties of 3-(1-methyl-5-pyrimidin-2-yl-1,2,4-triazol-3-yl)propanoic acid?
3-(1-methyl-5-pyrimidin-2-yl-1,2,4-triazol-3-yl)propanoic acid has a molecular weight of 233.23 g/mol, XLogP of 0.29, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-methyl-5-pyrimidin-2-yl-1,2,4-triazol-3-yl)propanoic acid is sourced from PubChem (CID 167058591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).