C22H27FN6O3 — CID 167059300
5-amino-3-[4-[2-[[3-(4-fluorobutyl)-1,2-oxazol-5-yl]amino]-2-oxoethyl]phenyl]-1-propan-2-ylpyrazole-4-carboxamide (PubChem CID 167059300) has the molecular formula C22H27FN6O3 and a molecular weight of 442.50 g/mol. Its IUPAC name is 5-amino-3-[4-[2-[[3-(4-fluorobutyl)-1,2-oxazol-5-yl]amino]-2-oxoethyl]phenyl]-1-propan-2-ylpyrazole-4-carboxamide.
| Compound Name | 5-amino-3-[4-[2-[[3-(4-fluorobutyl)-1,2-oxazol-5-yl]amino]-2-oxoethyl]phenyl]-1-propan-2-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 167059300 |
| Molecular Formula | C22H27FN6O3 |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | 5-amino-3-[4-[2-[[3-(4-fluorobutyl)-1,2-oxazol-5-yl]amino]-2-oxoethyl]phenyl]-1-propan-2-ylpyrazole-4-carboxamide |
| SMILES | CC(C)n1nc(-c2ccc(CC(=O)Nc3cc(CCCCF)no3)cc2)c(C(N)=O)c1N |
| InChI | InChI=1S/C22H27FN6O3/c1-13(2)29-21(24)19(22(25)31)20(27-29)15-8-6-14(7-9-15)11-17(30)26-18-12-16(28-32-18)5-3-4-10-23/h6-9,12-13H,3-5,10-11,24H2,1-2H3,(H2,25,31)(H,26,30) |
| InChIKey | JAVMGNGDZIMTLG-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 142.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|