About CID 167059649
CID 167059649 (PubChem CID 167059649) has the molecular formula C54H49F3O6S2
and a molecular weight of 915.11 g/mol.
Molecular Properties
| Compound Name | CID 167059649 |
| PubChem CID | 167059649 |
| Molecular Formula | C54H49F3O6S2 |
| Molecular Weight | 915.11 g/mol |
| Exact Mass | 914.29 |
| IUPAC Name | — |
| SMILES | C/C=C\C=C1\C(=O)/C(=C/c2cc3c(s2)C2=CC4C=C5OC6(CCCCC6)C6C=C(C=C7C(=O)C8=CCC(C)CC=C8C7=O)SC6C5=CC4C=C2OC32CCCCC2)C(=O)\C1=C\C(F)(F)F |
| InChI | InChI=1S/C54H49F3O6S2/c1-3-4-11-34-41(28-54(55,56)57)49(61)40(46(34)58)25-33-27-43-51(65-33)38-21-31-22-44-37(20-30(31)23-45(38)63-53(43)18-9-6-10-19-53)50-42(52(62-44)16-7-5-8-17-52)26-32(64-50)24-39-47(59)35-14-12-29(2)13-15-36(35)48(39)60/h3-4,11,14-15,20-31,42,50H,5-10,12-13,16-19H2,1-2H3/b4-3-,34-11+,39-24-,40-25-,41-28+ |
| InChIKey | JXCWZPAWHRWVRU-IIOFHDQWSA-N |
| XLogP | 12.51 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 65 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 915.11 |
| LogP ≤ 5 | 12.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze CID 167059649 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 167059649?
The IUPAC name of CID 167059649 (CID 167059649) is not available.
What is the SMILES notation for CID 167059649?
The canonical SMILES for CID 167059649 is C/C=C\C=C1\C(=O)/C(=C/c2cc3c(s2)C2=CC4C=C5OC6(CCCCC6)C6C=C(C=C7C(=O)C8=CCC(C)CC=C8C7=O)SC6C5=CC4C=C2OC32CCCCC2)C(=O)\C1=C\C(F)(F)F.
What is the InChIKey of CID 167059649?
The InChIKey is JXCWZPAWHRWVRU-IIOFHDQWSA-N. The full InChI is InChI=1S/C54H49F3O6S2/c1-3-4-11-34-41(28-54(55,56)57)49(61)40(46(34)58)25-33-27-43-51(65-33)38-21-31-22-44-37(20-30(31)23-45(38)63-53(43)18-9-6-10-19-53)50-42(52(62-44)16-7-5-8-17-52)26-32(64-50)24-39-47(59)35-14-12-29(2)13-15-36(35)48(39)60/h3-4,11,14-15,20-31,42,50H,5-10,12-13,16-19H2,1-2H3/b4-3-,34-11+,39-24-,40-25-,41-28+.
What are the key properties of CID 167059649?
CID 167059649 has a molecular weight of 915.11 g/mol, XLogP of 12.51, 3 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 167059649 is sourced from PubChem (CID 167059649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).