C23H17F2IO10S — CID 167060420
1,1-difluoro-2-[[9-[4-(4-iodophenoxy)phenoxy]carbonyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-2-oxoethanesulfonic acid (PubChem CID 167060420) has the molecular formula C23H17F2IO10S and a molecular weight of 650.35 g/mol. Its IUPAC name is 1,1-difluoro-2-[[9-[4-(4-iodophenoxy)phenoxy]carbonyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-2-oxoethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[[9-[4-(4-iodophenoxy)phenoxy]carbonyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 167060420 |
| Molecular Formula | C23H17F2IO10S |
| Molecular Weight | 650.35 g/mol |
| Exact Mass | 649.96 |
| IUPAC Name | 1,1-difluoro-2-[[9-[4-(4-iodophenoxy)phenoxy]carbonyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]-2-oxoethanesulfonic acid |
| SMILES | O=C1OC2C3CC(C2OC(=O)C(F)(F)S(=O)(=O)O)C(C(=O)Oc2ccc(Oc4ccc(I)cc4)cc2)C13 |
| InChI | InChI=1S/C23H17F2IO10S/c24-23(25,37(30,31)32)22(29)36-19-15-9-14-17(21(28)35-18(14)19)16(15)20(27)34-13-7-5-12(6-8-13)33-11-3-1-10(26)2-4-11/h1-8,14-19H,9H2,(H,30,31,32) |
| InChIKey | OYTFCDUVXTYQBP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 142.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.35 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|