C16H18F2N4O3 — CID 167060799
(9R)-3-(difluoromethyl)-13,13-dihydroxy-9-methyl-3,4,7,15-tetrazatricyclo[12.3.1.02,6]octadeca-1(18),2(6),4,14,16-pentaen-8-one (PubChem CID 167060799) has the molecular formula C16H18F2N4O3 and a molecular weight of 352.34 g/mol. Its IUPAC name is (9R)-3-(difluoromethyl)-13,13-dihydroxy-9-methyl-3,4,7,15-tetrazatricyclo[12.3.1.02,6]octadeca-1(18),2(6),4,14,16-pentaen-8-one.
| Compound Name | (9R)-3-(difluoromethyl)-13,13-dihydroxy-9-methyl-3,4,7,15-tetrazatricyclo[12.3.1.02,6]octadeca-1(18),2(6),4,14,16-pentaen-8-one |
|---|---|
| PubChem CID | 167060799 |
| Molecular Formula | C16H18F2N4O3 |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | (9R)-3-(difluoromethyl)-13,13-dihydroxy-9-methyl-3,4,7,15-tetrazatricyclo[12.3.1.02,6]octadeca-1(18),2(6),4,14,16-pentaen-8-one |
| SMILES | C[C@@H]1CCCC(O)(O)c2cc(ccn2)-c2c(cnn2C(F)F)NC1=O |
| InChI | InChI=1S/C16H18F2N4O3/c1-9-3-2-5-16(24,25)12-7-10(4-6-19-12)13-11(21-14(9)23)8-20-22(13)15(17)18/h4,6-9,15,24-25H,2-3,5H2,1H3,(H,21,23)/t9-/m1/s1 |
| InChIKey | UKXUEXIHTOCKST-SECBINFHSA-N |
| XLogP | 2.24 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|