C11H15NO2 — CID 167060814
(4R,5S)-5-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-4-methyl-1,3-oxazolidin-2-one (PubChem CID 167060814) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is (4R,5S)-5-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-4-methyl-1,3-oxazolidin-2-one.
| Compound Name | (4R,5S)-5-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-4-methyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 167060814 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | (4R,5S)-5-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-4-methyl-1,3-oxazolidin-2-one |
| SMILES | C=C(/C=C\C=C/C)[C@@H]1OC(=O)N[C@@H]1C |
| InChI | InChI=1S/C11H15NO2/c1-4-5-6-7-8(2)10-9(3)12-11(13)14-10/h4-7,9-10H,2H2,1,3H3,(H,12,13)/b5-4-,7-6-/t9-,10+/m1/s1 |
| InChIKey | FXTOMZDABMAADW-YLUSAMSGSA-N |
| XLogP | 2.17 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|