About 2-ethyl-3,4-difluoro-1-azacyclohepta-2,4,5,7-tetraene
2-ethyl-3,4-difluoro-1-azacyclohepta-2,4,5,7-tetraene (PubChem CID 167060967) has the molecular formula C8H7F2N
and a molecular weight of 155.15 g/mol. Its IUPAC name is 2-ethyl-3,4-difluoro-1-azacyclohepta-2,4,5,7-tetraene.
Analyze 2-ethyl-3,4-difluoro-1-azacyclohepta-2,4,5,7-tetraene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-3,4-difluoro-1-azacyclohepta-2,4,5,7-tetraene?
The IUPAC name of 2-ethyl-3,4-difluoro-1-azacyclohepta-2,4,5,7-tetraene (CID 167060967) is 2-ethyl-3,4-difluoro-1-azacyclohepta-2,4,5,7-tetraene.
What is the SMILES notation for 2-ethyl-3,4-difluoro-1-azacyclohepta-2,4,5,7-tetraene?
The canonical SMILES for 2-ethyl-3,4-difluoro-1-azacyclohepta-2,4,5,7-tetraene is CCC1=C(F)C(F)=C=CC=N1.
What is the InChIKey of 2-ethyl-3,4-difluoro-1-azacyclohepta-2,4,5,7-tetraene?
The InChIKey is MAPPSZKYQSIZIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7F2N/c1-2-7-8(10)6(9)4-3-5-11-7/h3,5H,2H2,1H3.
What are the key properties of 2-ethyl-3,4-difluoro-1-azacyclohepta-2,4,5,7-tetraene?
2-ethyl-3,4-difluoro-1-azacyclohepta-2,4,5,7-tetraene has a molecular weight of 155.15 g/mol, XLogP of 2.67, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-3,4-difluoro-1-azacyclohepta-2,4,5,7-tetraene is sourced from PubChem (CID 167060967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).