C15H19F6N5 — CID 167061122
6-(3,3-dimethylbut-1-ynyl)-2-N,4-N-bis[(2R)-1,1,1-trifluoropropan-2-yl]-1,3,5-triazine-2,4-diamine (PubChem CID 167061122) has the molecular formula C15H19F6N5 and a molecular weight of 383.34 g/mol. Its IUPAC name is 6-(3,3-dimethylbut-1-ynyl)-2-N,4-N-bis[(2R)-1,1,1-trifluoropropan-2-yl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(3,3-dimethylbut-1-ynyl)-2-N,4-N-bis[(2R)-1,1,1-trifluoropropan-2-yl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 167061122 |
| Molecular Formula | C15H19F6N5 |
| Molecular Weight | 383.34 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 6-(3,3-dimethylbut-1-ynyl)-2-N,4-N-bis[(2R)-1,1,1-trifluoropropan-2-yl]-1,3,5-triazine-2,4-diamine |
| SMILES | C[C@@H](Nc1nc(C#CC(C)(C)C)nc(N[C@H](C)C(F)(F)F)n1)C(F)(F)F |
| InChI | InChI=1S/C15H19F6N5/c1-8(14(16,17)18)22-11-24-10(6-7-13(3,4)5)25-12(26-11)23-9(2)15(19,20)21/h8-9H,1-5H3,(H2,22,23,24,25,26)/t8-,9-/m1/s1 |
| InChIKey | HPKLSIRNXDNXOU-RKDXNWHRSA-N |
| XLogP | 3.99 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.34 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|