C23H19F13N4 — CID 167061234
2-[2-cyano-5,5-dimethyl-3-[4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)piperidin-1-yl]cyclohex-2-en-1-ylidene]propanedinitrile (PubChem CID 167061234) has the molecular formula C23H19F13N4 and a molecular weight of 598.41 g/mol. Its IUPAC name is 2-[2-cyano-5,5-dimethyl-3-[4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)piperidin-1-yl]cyclohex-2-en-1-ylidene]propanedinitrile.
| Compound Name | 2-[2-cyano-5,5-dimethyl-3-[4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)piperidin-1-yl]cyclohex-2-en-1-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 167061234 |
| Molecular Formula | C23H19F13N4 |
| Molecular Weight | 598.41 g/mol |
| Exact Mass | 598.14 |
| IUPAC Name | 2-[2-cyano-5,5-dimethyl-3-[4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)piperidin-1-yl]cyclohex-2-en-1-ylidene]propanedinitrile |
| SMILES | CC1(C)CC(=C(C#N)C#N)C(C#N)=C(N2CCC(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CC2)C1 |
| InChI | InChI=1S/C23H19F13N4/c1-17(2)7-14(12(9-37)10-38)15(11-39)16(8-17)40-5-3-13(4-6-40)18(24,25)19(26,27)20(28,29)21(30,31)22(32,33)23(34,35)36/h13H,3-8H2,1-2H3 |
| InChIKey | LCVFRCSNUWVRAV-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 74.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.41 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|